About 1-ethyl-2-(4-fluoropenta-2,4-dien-2-yl)pyrrolidine
1-ethyl-2-(4-fluoropenta-2,4-dien-2-yl)pyrrolidine (PubChem CID 123887890) has the molecular formula C11H18FN
and a molecular weight of 183.27 g/mol. Its IUPAC name is 1-ethyl-2-(4-fluoropenta-2,4-dien-2-yl)pyrrolidine.
Molecular Properties
| Compound Name | 1-ethyl-2-(4-fluoropenta-2,4-dien-2-yl)pyrrolidine |
| PubChem CID | 123887890 |
| Molecular Formula | C11H18FN |
| Molecular Weight | 183.27 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 1-ethyl-2-(4-fluoropenta-2,4-dien-2-yl)pyrrolidine |
| SMILES | C=C(F)C=C(C)C1CCCN1CC |
| InChI | InChI=1S/C11H18FN/c1-4-13-7-5-6-11(13)9(2)8-10(3)12/h8,11H,3-7H2,1-2H3 |
| InChIKey | JCHGYVQSPSDSQG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-2-(4-fluoropenta-2,4-dien-2-yl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2-(4-fluoropenta-2,4-dien-2-yl)pyrrolidine?
The IUPAC name of 1-ethyl-2-(4-fluoropenta-2,4-dien-2-yl)pyrrolidine (CID 123887890) is 1-ethyl-2-(4-fluoropenta-2,4-dien-2-yl)pyrrolidine.
What is the SMILES notation for 1-ethyl-2-(4-fluoropenta-2,4-dien-2-yl)pyrrolidine?
The canonical SMILES for 1-ethyl-2-(4-fluoropenta-2,4-dien-2-yl)pyrrolidine is C=C(F)C=C(C)C1CCCN1CC.
What is the InChIKey of 1-ethyl-2-(4-fluoropenta-2,4-dien-2-yl)pyrrolidine?
The InChIKey is JCHGYVQSPSDSQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18FN/c1-4-13-7-5-6-11(13)9(2)8-10(3)12/h8,11H,3-7H2,1-2H3.
What are the key properties of 1-ethyl-2-(4-fluoropenta-2,4-dien-2-yl)pyrrolidine?
1-ethyl-2-(4-fluoropenta-2,4-dien-2-yl)pyrrolidine has a molecular weight of 183.27 g/mol, XLogP of 2.90, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2-(4-fluoropenta-2,4-dien-2-yl)pyrrolidine is sourced from PubChem (CID 123887890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).