C25H28N6O4 — CID 123887972
4-[2-(7,8-dimethyl-2,4-dioxo-1H-benzo[g]pteridin-3-yl)ethylamino]-N-phenylmethoxybutanamide (PubChem CID 123887972) has the molecular formula C25H28N6O4 and a molecular weight of 476.54 g/mol. Its IUPAC name is 4-[2-(7,8-dimethyl-2,4-dioxo-1H-benzo[g]pteridin-3-yl)ethylamino]-N-phenylmethoxybutanamide.
| Compound Name | 4-[2-(7,8-dimethyl-2,4-dioxo-1H-benzo[g]pteridin-3-yl)ethylamino]-N-phenylmethoxybutanamide |
|---|---|
| PubChem CID | 123887972 |
| Molecular Formula | C25H28N6O4 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | 4-[2-(7,8-dimethyl-2,4-dioxo-1H-benzo[g]pteridin-3-yl)ethylamino]-N-phenylmethoxybutanamide |
| SMILES | Cc1cc2nc3[nH]c(=O)n(CCNCCCC(=O)NOCc4ccccc4)c(=O)c3nc2cc1C |
| InChI | InChI=1S/C25H28N6O4/c1-16-13-19-20(14-17(16)2)28-23-22(27-19)24(33)31(25(34)29-23)12-11-26-10-6-9-21(32)30-35-15-18-7-4-3-5-8-18/h3-5,7-8,13-14,26H,6,9-12,15H2,1-2H3,(H,30,32)(H,28,29,34) |
| InChIKey | QSUOUTGXWSWUJF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|