About pentacyclo[4.4.1.11,6.03,9.04,8]dodecane
pentacyclo[4.4.1.11,6.03,9.04,8]dodecane (PubChem CID 123888133) has the molecular formula C12H16
and a molecular weight of 160.26 g/mol. Its IUPAC name is pentacyclo[4.4.1.11,6.03,9.04,8]dodecane.
Molecular Properties
| Compound Name | pentacyclo[4.4.1.11,6.03,9.04,8]dodecane |
| PubChem CID | 123888133 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | pentacyclo[4.4.1.11,6.03,9.04,8]dodecane |
| SMILES | C1C2C3CC14CC1(CC2C3C1)C4 |
| InChI | InChI=1S/C12H16/c1-7-8-2-11(1)5-12(6-11)3-9(7)10(8)4-12/h7-10H,1-6H2 |
| InChIKey | DGYZFTKCKXKNPX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze pentacyclo[4.4.1.11,6.03,9.04,8]dodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentacyclo[4.4.1.11,6.03,9.04,8]dodecane?
The IUPAC name of pentacyclo[4.4.1.11,6.03,9.04,8]dodecane (CID 123888133) is pentacyclo[4.4.1.11,6.03,9.04,8]dodecane.
What is the SMILES notation for pentacyclo[4.4.1.11,6.03,9.04,8]dodecane?
The canonical SMILES for pentacyclo[4.4.1.11,6.03,9.04,8]dodecane is C1C2C3CC14CC1(CC2C3C1)C4.
What is the InChIKey of pentacyclo[4.4.1.11,6.03,9.04,8]dodecane?
The InChIKey is DGYZFTKCKXKNPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16/c1-7-8-2-11(1)5-12(6-11)3-9(7)10(8)4-12/h7-10H,1-6H2.
What are the key properties of pentacyclo[4.4.1.11,6.03,9.04,8]dodecane?
pentacyclo[4.4.1.11,6.03,9.04,8]dodecane has a molecular weight of 160.26 g/mol, XLogP of 2.83, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for pentacyclo[4.4.1.11,6.03,9.04,8]dodecane is sourced from PubChem (CID 123888133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).