C36H42ClFN2O2S — CID 123888210
5-(4-chlorophenyl)-4-[1-(N-cyclopropylsulfanyl-2-fluoroanilino)butan-2-yl]-6-(3-ethylphenyl)-2-pent-3-en-2-ylmorpholin-3-one (PubChem CID 123888210) has the molecular formula C36H42ClFN2O2S and a molecular weight of 621.26 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-4-[1-(N-cyclopropylsulfanyl-2-fluoroanilino)butan-2-yl]-6-(3-ethylphenyl)-2-pent-3-en-2-ylmorpholin-3-one.
| Compound Name | 5-(4-chlorophenyl)-4-[1-(N-cyclopropylsulfanyl-2-fluoroanilino)butan-2-yl]-6-(3-ethylphenyl)-2-pent-3-en-2-ylmorpholin-3-one |
|---|---|
| PubChem CID | 123888210 |
| Molecular Formula | C36H42ClFN2O2S |
| Molecular Weight | 621.26 g/mol |
| Exact Mass | 620.26 |
| IUPAC Name | 5-(4-chlorophenyl)-4-[1-(N-cyclopropylsulfanyl-2-fluoroanilino)butan-2-yl]-6-(3-ethylphenyl)-2-pent-3-en-2-ylmorpholin-3-one |
| SMILES | CC=CC(C)C1OC(c2cccc(CC)c2)C(c2ccc(Cl)cc2)N(C(CC)CN(SC2CC2)c2ccccc2F)C1=O |
| InChI | InChI=1S/C36H42ClFN2O2S/c1-5-11-24(4)34-36(41)40(29(7-3)23-39(43-30-20-21-30)32-15-9-8-14-31(32)38)33(26-16-18-28(37)19-17-26)35(42-34)27-13-10-12-25(6-2)22-27/h5,8-19,22,24,29-30,33-35H,6-7,20-21,23H2,1-4H3 |
| InChIKey | KMUNPOQGIBFEHZ-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.26 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|