C68H60N12O2S — CID 123888479
2-(4-phenylphenyl)-N,N'-bis[4-[3-[4-(pyridin-3-ylmethyl)piperazin-1-yl]quinoxalin-6-yl]phenyl]-3-thiophen-2-ylbutanediamide (PubChem CID 123888479) has the molecular formula C68H60N12O2S and a molecular weight of 1109.38 g/mol. Its IUPAC name is 2-(4-phenylphenyl)-N,N'-bis[4-[3-[4-(pyridin-3-ylmethyl)piperazin-1-yl]quinoxalin-6-yl]phenyl]-3-thiophen-2-ylbutanediamide.
| Compound Name | 2-(4-phenylphenyl)-N,N'-bis[4-[3-[4-(pyridin-3-ylmethyl)piperazin-1-yl]quinoxalin-6-yl]phenyl]-3-thiophen-2-ylbutanediamide |
|---|---|
| PubChem CID | 123888479 |
| Molecular Formula | C68H60N12O2S |
| Molecular Weight | 1109.38 g/mol |
| Exact Mass | 1108.47 |
| IUPAC Name | 2-(4-phenylphenyl)-N,N'-bis[4-[3-[4-(pyridin-3-ylmethyl)piperazin-1-yl]quinoxalin-6-yl]phenyl]-3-thiophen-2-ylbutanediamide |
| SMILES | O=C(Nc1ccc(-c2ccc3ncc(N4CCN(Cc5cccnc5)CC4)nc3c2)cc1)C(c1ccc(-c2ccccc2)cc1)C(C(=O)Nc1ccc(-c2ccc3ncc(N4CCN(Cc5cccnc5)CC4)nc3c2)cc1)c1cccs1 |
| InChI | InChI=1S/C68H60N12O2S/c81-67(73-56-22-16-51(17-23-56)54-20-26-58-60(39-54)75-63(43-71-58)79-34-30-77(31-35-79)45-47-7-4-28-69-41-47)65(53-14-12-50(13-15-53)49-9-2-1-3-10-49)66(62-11-6-38-83-62)68(82)74-57-24-18-52(19-25-57)55-21-27-59-61(40-55)76-64(44-72-59)80-36-32-78(33-37-80)46-48-8-5-29-70-42-48/h1-29,38-44,65-66H,30-37,45-46H2,(H,73,81)(H,74,82) |
| InChIKey | SRLSBJCDZFAFFL-UHFFFAOYSA-N |
| XLogP | 12.21 |
| TPSA | 148.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 83 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1109.38 |
| LogP ≤ 5 | 12.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |