C27H35N5O3 — CID 123888539
7,8-dimethoxy-N,4-dimethyl-1-[4-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)phenyl]-4,5-dihydro-2,3-benzodiazepine-3-carboxamide (PubChem CID 123888539) has the molecular formula C27H35N5O3 and a molecular weight of 477.61 g/mol. Its IUPAC name is 7,8-dimethoxy-N,4-dimethyl-1-[4-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)phenyl]-4,5-dihydro-2,3-benzodiazepine-3-carboxamide.
| Compound Name | 7,8-dimethoxy-N,4-dimethyl-1-[4-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)phenyl]-4,5-dihydro-2,3-benzodiazepine-3-carboxamide |
|---|---|
| PubChem CID | 123888539 |
| Molecular Formula | C27H35N5O3 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.27 |
| IUPAC Name | 7,8-dimethoxy-N,4-dimethyl-1-[4-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)phenyl]-4,5-dihydro-2,3-benzodiazepine-3-carboxamide |
| SMILES | CNC(=O)N1N=C(c2ccc(N3CC4CN(C)CC4C3)cc2)c2cc(OC)c(OC)cc2CC1C |
| InChI | InChI=1S/C27H35N5O3/c1-17-10-19-11-24(34-4)25(35-5)12-23(19)26(29-32(17)27(33)28-2)18-6-8-22(9-7-18)31-15-20-13-30(3)14-21(20)16-31/h6-9,11-12,17,20-21H,10,13-16H2,1-5H3,(H,28,33) |
| InChIKey | KMTKPDISNJAURW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |