C22H35NO2 — CID 123888922
N-butyl-7-(3-ethoxy-4-methylcyclohexa-1,3-dien-1-yl)-N-ethylhepta-2,4-dienamide (PubChem CID 123888922) has the molecular formula C22H35NO2 and a molecular weight of 345.53 g/mol. Its IUPAC name is N-butyl-7-(3-ethoxy-4-methylcyclohexa-1,3-dien-1-yl)-N-ethylhepta-2,4-dienamide.
| Compound Name | N-butyl-7-(3-ethoxy-4-methylcyclohexa-1,3-dien-1-yl)-N-ethylhepta-2,4-dienamide |
|---|---|
| PubChem CID | 123888922 |
| Molecular Formula | C22H35NO2 |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.27 |
| IUPAC Name | N-butyl-7-(3-ethoxy-4-methylcyclohexa-1,3-dien-1-yl)-N-ethylhepta-2,4-dienamide |
| SMILES | CCCCN(CC)C(=O)C=CC=CCCC1=CC(OCC)=C(C)CC1 |
| InChI | InChI=1S/C22H35NO2/c1-5-8-17-23(6-2)22(24)14-12-10-9-11-13-20-16-15-19(4)21(18-20)25-7-3/h9-10,12,14,18H,5-8,11,13,15-17H2,1-4H3 |
| InChIKey | OYNFLZHTDDPKHE-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|