About hepta-1,3,5-trien-2-ylsilane
hepta-1,3,5-trien-2-ylsilane (PubChem CID 123889240) has the molecular formula C7H12Si
and a molecular weight of 124.26 g/mol. Its IUPAC name is hepta-1,3,5-trien-2-ylsilane.
Molecular Properties
| Compound Name | hepta-1,3,5-trien-2-ylsilane |
| PubChem CID | 123889240 |
| Molecular Formula | C7H12Si |
| Molecular Weight | 124.26 g/mol |
| Exact Mass | 124.07 |
| IUPAC Name | hepta-1,3,5-trien-2-ylsilane |
| SMILES | C=C([SiH3])C=CC=CC |
| InChI | InChI=1S/C7H12Si/c1-3-4-5-6-7(2)8/h3-6H,2H2,1,8H3 |
| InChIKey | IZXLUCWDHXOMRS-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.26 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze hepta-1,3,5-trien-2-ylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hepta-1,3,5-trien-2-ylsilane?
The IUPAC name of hepta-1,3,5-trien-2-ylsilane (CID 123889240) is hepta-1,3,5-trien-2-ylsilane.
What is the SMILES notation for hepta-1,3,5-trien-2-ylsilane?
The canonical SMILES for hepta-1,3,5-trien-2-ylsilane is C=C([SiH3])C=CC=CC.
What is the InChIKey of hepta-1,3,5-trien-2-ylsilane?
The InChIKey is IZXLUCWDHXOMRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12Si/c1-3-4-5-6-7(2)8/h3-6H,2H2,1,8H3.
What are the key properties of hepta-1,3,5-trien-2-ylsilane?
hepta-1,3,5-trien-2-ylsilane has a molecular weight of 124.26 g/mol, XLogP of 1.00, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hepta-1,3,5-trien-2-ylsilane is sourced from PubChem (CID 123889240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).