C22H6N4S4 — CID 123889277
2-[[15-(2,2-dicyanoethenyl)-5,9,14,18-tetrathiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaen-6-yl]methylidene]propanedinitrile (PubChem CID 123889277) has the molecular formula C22H6N4S4 and a molecular weight of 454.59 g/mol. Its IUPAC name is 2-[[15-(2,2-dicyanoethenyl)-5,9,14,18-tetrathiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaen-6-yl]methylidene]propanedinitrile.
| Compound Name | 2-[[15-(2,2-dicyanoethenyl)-5,9,14,18-tetrathiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaen-6-yl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 123889277 |
| Molecular Formula | C22H6N4S4 |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 453.95 |
| IUPAC Name | 2-[[15-(2,2-dicyanoethenyl)-5,9,14,18-tetrathiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaen-6-yl]methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=Cc1cc2sc3cc4c(cc3c2s1)sc1cc(C=C(C#N)C#N)sc14 |
| InChI | InChI=1S/C22H6N4S4/c23-7-11(8-24)1-13-3-19-21(27-13)15-5-18-16(6-17(15)29-19)22-20(30-18)4-14(28-22)2-12(9-25)10-26/h1-6H |
| InChIKey | JYRLPFGDCKRDLZ-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|