About (2,5-dihydroxypyrrol-1-yl) N-[4-[2-(diethylamino)ethylcarbamoyl]phenyl]carbamate
(2,5-dihydroxypyrrol-1-yl) N-[4-[2-(diethylamino)ethylcarbamoyl]phenyl]carbamate (PubChem CID 123889450) has the molecular formula C18H24N4O5
and a molecular weight of 376.41 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) N-[4-[2-(diethylamino)ethylcarbamoyl]phenyl]carbamate.
Molecular Properties
| Compound Name | (2,5-dihydroxypyrrol-1-yl) N-[4-[2-(diethylamino)ethylcarbamoyl]phenyl]carbamate |
| PubChem CID | 123889450 |
| Molecular Formula | C18H24N4O5 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) N-[4-[2-(diethylamino)ethylcarbamoyl]phenyl]carbamate |
| SMILES | CCN(CC)CCNC(=O)c1ccc(NC(=O)On2c(O)ccc2O)cc1 |
| InChI | InChI=1S/C18H24N4O5/c1-3-21(4-2)12-11-19-17(25)13-5-7-14(8-6-13)20-18(26)27-22-15(23)9-10-16(22)24/h5-10,23-24H,3-4,11-12H2,1-2H3,(H,19,25)(H,20,26) |
| InChIKey | JZWZIGIHGOPJOV-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 116.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (2,5-dihydroxypyrrol-1-yl) N-[4-[2-(diethylamino)ethylcarbamoyl]phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dihydroxypyrrol-1-yl) N-[4-[2-(diethylamino)ethylcarbamoyl]phenyl]carbamate?
The IUPAC name of (2,5-dihydroxypyrrol-1-yl) N-[4-[2-(diethylamino)ethylcarbamoyl]phenyl]carbamate (CID 123889450) is (2,5-dihydroxypyrrol-1-yl) N-[4-[2-(diethylamino)ethylcarbamoyl]phenyl]carbamate.
What is the SMILES notation for (2,5-dihydroxypyrrol-1-yl) N-[4-[2-(diethylamino)ethylcarbamoyl]phenyl]carbamate?
The canonical SMILES for (2,5-dihydroxypyrrol-1-yl) N-[4-[2-(diethylamino)ethylcarbamoyl]phenyl]carbamate is CCN(CC)CCNC(=O)c1ccc(NC(=O)On2c(O)ccc2O)cc1.
What is the InChIKey of (2,5-dihydroxypyrrol-1-yl) N-[4-[2-(diethylamino)ethylcarbamoyl]phenyl]carbamate?
The InChIKey is JZWZIGIHGOPJOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N4O5/c1-3-21(4-2)12-11-19-17(25)13-5-7-14(8-6-13)20-18(26)27-22-15(23)9-10-16(22)24/h5-10,23-24H,3-4,11-12H2,1-2H3,(H,19,25)(H,20,26).
What are the key properties of (2,5-dihydroxypyrrol-1-yl) N-[4-[2-(diethylamino)ethylcarbamoyl]phenyl]carbamate?
(2,5-dihydroxypyrrol-1-yl) N-[4-[2-(diethylamino)ethylcarbamoyl]phenyl]carbamate has a molecular weight of 376.41 g/mol, XLogP of 1.63, 8 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dihydroxypyrrol-1-yl) N-[4-[2-(diethylamino)ethylcarbamoyl]phenyl]carbamate is sourced from PubChem (CID 123889450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).