C12H19NO3 — CID 123889464
(3R,7aR)-3-tert-butyl-6-ethyl-3,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-5,7-dione (PubChem CID 123889464) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is (3R,7aR)-3-tert-butyl-6-ethyl-3,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-5,7-dione.
| Compound Name | (3R,7aR)-3-tert-butyl-6-ethyl-3,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-5,7-dione |
|---|---|
| PubChem CID | 123889464 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | (3R,7aR)-3-tert-butyl-6-ethyl-3,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-5,7-dione |
| SMILES | CCC1C(=O)[C@H]2CO[C@H](C(C)(C)C)N2C1=O |
| InChI | InChI=1S/C12H19NO3/c1-5-7-9(14)8-6-16-11(12(2,3)4)13(8)10(7)15/h7-8,11H,5-6H2,1-4H3/t7?,8-,11-/m1/s1 |
| InChIKey | YLUOMKCKLKULQA-XLQYWTITSA-N |
| XLogP | 1.19 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|