C22H20N4O3 — CID 123889880
1-[2-methyl-5-[(4-oxo-3H-phthalazin-1-yl)oxy]benzoyl]piperidine-4-carbonitrile (PubChem CID 123889880) has the molecular formula C22H20N4O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is 1-[2-methyl-5-[(4-oxo-3H-phthalazin-1-yl)oxy]benzoyl]piperidine-4-carbonitrile.
| Compound Name | 1-[2-methyl-5-[(4-oxo-3H-phthalazin-1-yl)oxy]benzoyl]piperidine-4-carbonitrile |
|---|---|
| PubChem CID | 123889880 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 1-[2-methyl-5-[(4-oxo-3H-phthalazin-1-yl)oxy]benzoyl]piperidine-4-carbonitrile |
| SMILES | Cc1ccc(Oc2n[nH]c(=O)c3ccccc23)cc1C(=O)N1CCC(C#N)CC1 |
| InChI | InChI=1S/C22H20N4O3/c1-14-6-7-16(12-19(14)22(28)26-10-8-15(13-23)9-11-26)29-21-18-5-3-2-4-17(18)20(27)24-25-21/h2-7,12,15H,8-11H2,1H3,(H,24,27) |
| InChIKey | PVFYWBBWOOWRPW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |