C25H34F3N3O2S — CID 123889913
9-[imino-(9-methyl-5,6-dimethylideneundeca-1,3,7,9-tetraen-2-yl)-methylidene-λ6-sulfanyl]-4-(2,2,2-trifluoroethyl)-1-oxa-4,9-diazaspiro[5.5]undecan-3-one (PubChem CID 123889913) has the molecular formula C25H34F3N3O2S and a molecular weight of 497.63 g/mol. Its IUPAC name is 9-[imino-(9-methyl-5,6-dimethylideneundeca-1,3,7,9-tetraen-2-yl)-methylidene-λ6-sulfanyl]-4-(2,2,2-trifluoroethyl)-1-oxa-4,9-diazaspiro[5.5]undecan-3-one.
| Compound Name | 9-[imino-(9-methyl-5,6-dimethylideneundeca-1,3,7,9-tetraen-2-yl)-methylidene-λ6-sulfanyl]-4-(2,2,2-trifluoroethyl)-1-oxa-4,9-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 123889913 |
| Molecular Formula | C25H34F3N3O2S |
| Molecular Weight | 497.63 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | 9-[imino-(9-methyl-5,6-dimethylideneundeca-1,3,7,9-tetraen-2-yl)-methylidene-λ6-sulfanyl]-4-(2,2,2-trifluoroethyl)-1-oxa-4,9-diazaspiro[5.5]undecan-3-one |
| SMILES | [H]N=S(=C)(C(=C)C=CC(=C)C(=C)C=CC(C)=CC)N1CCC2(CC1)CN(CC(F)(F)F)C(=O)CO2 |
| InChI | InChI=1S/C25H34F3N3O2S/c1-7-19(2)8-9-20(3)21(4)10-11-22(5)34(6,29)31-14-12-24(13-15-31)17-30(18-25(26,27)28)23(32)16-33-24/h7-11,29H,3-6,12-18H2,1-2H3 |
| InChIKey | WZCYNHXZAHVIAA-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 56.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.63 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|