C9H10O2 — CID 123890375
2,3,3a,7a-tetrahydro-1-benzofuran-4-carbaldehyde (PubChem CID 123890375) has the molecular formula C9H10O2 and a molecular weight of 150.18 g/mol. Its IUPAC name is 2,3,3a,7a-tetrahydro-1-benzofuran-4-carbaldehyde.
| Compound Name | 2,3,3a,7a-tetrahydro-1-benzofuran-4-carbaldehyde |
|---|---|
| PubChem CID | 123890375 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 2,3,3a,7a-tetrahydro-1-benzofuran-4-carbaldehyde |
| SMILES | O=CC1=CC=CC2OCCC12 |
| InChI | InChI=1S/C9H10O2/c10-6-7-2-1-3-9-8(7)4-5-11-9/h1-3,6,8-9H,4-5H2 |
| InChIKey | WIMHOGXHSVTWOP-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|