C18H19N5O — CID 123890594
3,4-dimethyl-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]azete-2-carboxamide (PubChem CID 123890594) has the molecular formula C18H19N5O and a molecular weight of 321.38 g/mol. Its IUPAC name is 3,4-dimethyl-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]azete-2-carboxamide.
| Compound Name | 3,4-dimethyl-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]azete-2-carboxamide |
|---|---|
| PubChem CID | 123890594 |
| Molecular Formula | C18H19N5O |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 3,4-dimethyl-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]azete-2-carboxamide |
| SMILES | CC1=C(C)C(C(=O)Nc2cnc3[nH]c(C4=CCNCC4)cc3c2)=N1 |
| InChI | InChI=1S/C18H19N5O/c1-10-11(2)21-16(10)18(24)22-14-7-13-8-15(23-17(13)20-9-14)12-3-5-19-6-4-12/h3,7-9,19H,4-6H2,1-2H3,(H,20,23)(H,22,24) |
| InChIKey | APCFEOHXIXSCNG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |