C17H18BrF2N3O2S — CID 123890602
N-(2'-amino-7-bromospiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-thiazole]-2-yl)-2,2-difluoroacetamide (PubChem CID 123890602) has the molecular formula C17H18BrF2N3O2S and a molecular weight of 446.32 g/mol. Its IUPAC name is N-(2'-amino-7-bromospiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-thiazole]-2-yl)-2,2-difluoroacetamide.
| Compound Name | N-(2'-amino-7-bromospiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-thiazole]-2-yl)-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 123890602 |
| Molecular Formula | C17H18BrF2N3O2S |
| Molecular Weight | 446.32 g/mol |
| Exact Mass | 445.03 |
| IUPAC Name | N-(2'-amino-7-bromospiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-thiazole]-2-yl)-2,2-difluoroacetamide |
| SMILES | NC1=NC2(CS1)c1cc(Br)ccc1OC1CCC(NC(=O)C(F)F)CC12 |
| InChI | InChI=1S/C17H18BrF2N3O2S/c18-8-1-3-12-10(5-8)17(7-26-16(21)23-17)11-6-9(2-4-13(11)25-12)22-15(24)14(19)20/h1,3,5,9,11,13-14H,2,4,6-7H2,(H2,21,23)(H,22,24) |
| InChIKey | DMCBXTROVOGETA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |