C39H56NO2+ — CID 123890741
6-[18-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-1,1,5-trimethyl-3,4-dihydro-2H-pyridin-1-ium-3-ol (PubChem CID 123890741) has the molecular formula C39H56NO2+ and a molecular weight of 570.88 g/mol. Its IUPAC name is 6-[18-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-1,1,5-trimethyl-3,4-dihydro-2H-pyridin-1-ium-3-ol.
| Compound Name | 6-[18-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-1,1,5-trimethyl-3,4-dihydro-2H-pyridin-1-ium-3-ol |
|---|---|
| PubChem CID | 123890741 |
| Molecular Formula | C39H56NO2+ |
| Molecular Weight | 570.88 g/mol |
| Exact Mass | 570.43 |
| IUPAC Name | 6-[18-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-1,1,5-trimethyl-3,4-dihydro-2H-pyridin-1-ium-3-ol |
| SMILES | CC(C=CC=C(C)C=CC1=C(C)CC(O)CC1(C)C)=CC=CC=C(C)C=CC=C(C)C=CC1=C(C)CC(O)C[N+]1(C)C |
| InChI | InChI=1S/C39H56NO2/c1-29(17-13-19-31(3)21-23-37-33(5)25-35(41)27-39(37,7)8)15-11-12-16-30(2)18-14-20-32(4)22-24-38-34(6)26-36(42)28-40(38,9)10/h11-24,35-36,41-42H,25-28H2,1-10H3/q+1 |
| InChIKey | GEXZZVUZUQAACR-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.88 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|