C58H97NO3Si — CID 123890869
[(6R)-6-[tert-butyl(diphenyl)silyl]oxyhexatriaconta-8,27,30-trien-18-yl] 4-(dimethylamino)butanoate (PubChem CID 123890869) has the molecular formula C58H97NO3Si and a molecular weight of 884.50 g/mol. Its IUPAC name is [(6R)-6-[tert-butyl(diphenyl)silyl]oxyhexatriaconta-8,27,30-trien-18-yl] 4-(dimethylamino)butanoate.
| Compound Name | [(6R)-6-[tert-butyl(diphenyl)silyl]oxyhexatriaconta-8,27,30-trien-18-yl] 4-(dimethylamino)butanoate |
|---|---|
| PubChem CID | 123890869 |
| Molecular Formula | C58H97NO3Si |
| Molecular Weight | 884.50 g/mol |
| Exact Mass | 883.72 |
| IUPAC Name | [(6R)-6-[tert-butyl(diphenyl)silyl]oxyhexatriaconta-8,27,30-trien-18-yl] 4-(dimethylamino)butanoate |
| SMILES | CCCCCC=CCC=CCCCCCCCCC(CCCCCCCCC=CC[C@@H](CCCCC)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC(=O)CCCN(C)C |
| InChI | InChI=1S/C58H97NO3Si/c1-8-10-12-13-14-15-16-17-18-19-20-21-23-26-29-35-43-53(61-57(60)51-42-52-59(6)7)44-36-30-27-24-22-25-28-31-37-46-54(45-34-11-9-2)62-63(58(3,4)5,55-47-38-32-39-48-55)56-49-40-33-41-50-56/h14-15,17-18,31-33,37-41,47-50,53-54H,8-13,16,19-30,34-36,42-46,51-52H2,1-7H3/t53?,54-/m1/s1 |
| InChIKey | QQVUPVIULCOVTO-HVISTYRSSA-N |
| XLogP | 16.04 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.50 |
| LogP ≤ 5 | 16.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|