C14H22FN — CID 123891038
9-fluoro-4,5-dimethyl-8-methylideneundeca-5,9-dien-3-imine (PubChem CID 123891038) has the molecular formula C14H22FN and a molecular weight of 223.33 g/mol. Its IUPAC name is 9-fluoro-4,5-dimethyl-8-methylideneundeca-5,9-dien-3-imine.
| Compound Name | 9-fluoro-4,5-dimethyl-8-methylideneundeca-5,9-dien-3-imine |
|---|---|
| PubChem CID | 123891038 |
| Molecular Formula | C14H22FN |
| Molecular Weight | 223.33 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 9-fluoro-4,5-dimethyl-8-methylideneundeca-5,9-dien-3-imine |
| SMILES | [H]/N=C(\CC)C(C)C(C)=CCC(=C)C(F)=CC |
| InChI | InChI=1S/C14H22FN/c1-6-13(15)11(4)9-8-10(3)12(5)14(16)7-2/h6,8,12,16H,4,7,9H2,1-3,5H3/b10-8?,13-6?,16-14+ |
| InChIKey | JQZGKZZUGIDDIZ-DMYBXRHHSA-N |
| XLogP | 4.82 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.33 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|