C28H31BO4 — CID 123891293
5-bis(2,4,6-trimethylphenyl)boranyl-4,6-dimethylbenzene-1,3-dicarboxylic acid (PubChem CID 123891293) has the molecular formula C28H31BO4 and a molecular weight of 442.36 g/mol. Its IUPAC name is 5-bis(2,4,6-trimethylphenyl)boranyl-4,6-dimethylbenzene-1,3-dicarboxylic acid.
| Compound Name | 5-bis(2,4,6-trimethylphenyl)boranyl-4,6-dimethylbenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 123891293 |
| Molecular Formula | C28H31BO4 |
| Molecular Weight | 442.36 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 5-bis(2,4,6-trimethylphenyl)boranyl-4,6-dimethylbenzene-1,3-dicarboxylic acid |
| SMILES | Cc1cc(C)c(B(c2c(C)cc(C)cc2C)c2c(C)c(C(=O)O)cc(C(=O)O)c2C)c(C)c1 |
| InChI | InChI=1S/C28H31BO4/c1-14-9-16(3)24(17(4)10-14)29(25-18(5)11-15(2)12-19(25)6)26-20(7)22(27(30)31)13-23(21(26)8)28(32)33/h9-13H,1-8H3,(H,30,31)(H,32,33) |
| InChIKey | QUSRTTSUKFTQQI-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.36 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|