C22H25F5O2S — CID 123892429
3,3-dibutyl-8-methyl-6-(2,3,4,5,6-pentafluorophenyl)-2,4-dihydrothieno[3,4-b][1,4]dioxepine (PubChem CID 123892429) has the molecular formula C22H25F5O2S and a molecular weight of 448.50 g/mol. Its IUPAC name is 3,3-dibutyl-8-methyl-6-(2,3,4,5,6-pentafluorophenyl)-2,4-dihydrothieno[3,4-b][1,4]dioxepine.
| Compound Name | 3,3-dibutyl-8-methyl-6-(2,3,4,5,6-pentafluorophenyl)-2,4-dihydrothieno[3,4-b][1,4]dioxepine |
|---|---|
| PubChem CID | 123892429 |
| Molecular Formula | C22H25F5O2S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 3,3-dibutyl-8-methyl-6-(2,3,4,5,6-pentafluorophenyl)-2,4-dihydrothieno[3,4-b][1,4]dioxepine |
| SMILES | CCCCC1(CCCC)COc2c(C)sc(-c3c(F)c(F)c(F)c(F)c3F)c2OC1 |
| InChI | InChI=1S/C22H25F5O2S/c1-4-6-8-22(9-7-5-2)10-28-19-12(3)30-21(20(19)29-11-22)13-14(23)16(25)18(27)17(26)15(13)24/h4-11H2,1-3H3 |
| InChIKey | SXHPDZCMPPIHCQ-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|