C24H25FN2O4S — CID 123892430
5-[[7-[(3-fluorophenyl)methoxymethyl]-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]sulfonyl]-2-methylhexa-2,4-dienenitrile (PubChem CID 123892430) has the molecular formula C24H25FN2O4S and a molecular weight of 456.54 g/mol. Its IUPAC name is 5-[[7-[(3-fluorophenyl)methoxymethyl]-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]sulfonyl]-2-methylhexa-2,4-dienenitrile.
| Compound Name | 5-[[7-[(3-fluorophenyl)methoxymethyl]-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]sulfonyl]-2-methylhexa-2,4-dienenitrile |
|---|---|
| PubChem CID | 123892430 |
| Molecular Formula | C24H25FN2O4S |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 5-[[7-[(3-fluorophenyl)methoxymethyl]-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]sulfonyl]-2-methylhexa-2,4-dienenitrile |
| SMILES | CC(C#N)=CC=C(C)S(=O)(=O)N1CCOc2ccc(COCc3cccc(F)c3)cc2C1 |
| InChI | InChI=1S/C24H25FN2O4S/c1-18(14-26)6-7-19(2)32(28,29)27-10-11-31-24-9-8-21(12-22(24)15-27)17-30-16-20-4-3-5-23(25)13-20/h3-9,12-13H,10-11,15-17H2,1-2H3 |
| InChIKey | QTKCQWIERIMUOW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|