C23H18F4N2O2 — CID 123892553
N-[3-(6-fluoro-5-propanoyl-2-pyridinyl)-4-methylphenyl]-3-(trifluoromethyl)benzamide (PubChem CID 123892553) has the molecular formula C23H18F4N2O2 and a molecular weight of 430.40 g/mol. Its IUPAC name is N-[3-(6-fluoro-5-propanoyl-2-pyridinyl)-4-methylphenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[3-(6-fluoro-5-propanoyl-2-pyridinyl)-4-methylphenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 123892553 |
| Molecular Formula | C23H18F4N2O2 |
| Molecular Weight | 430.40 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | N-[3-(6-fluoro-5-propanoyl-2-pyridinyl)-4-methylphenyl]-3-(trifluoromethyl)benzamide |
| SMILES | CCC(=O)c1ccc(-c2cc(NC(=O)c3cccc(C(F)(F)F)c3)ccc2C)nc1F |
| InChI | InChI=1S/C23H18F4N2O2/c1-3-20(30)17-9-10-19(29-21(17)24)18-12-16(8-7-13(18)2)28-22(31)14-5-4-6-15(11-14)23(25,26)27/h4-12H,3H2,1-2H3,(H,28,31) |
| InChIKey | JAYOSXDFXXHOSJ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.40 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|