C26H47NO4SSi2 — CID 123893018
[2,6,10,12,12-pentamethyl-13,13-bis(methylsilyloxy)-1-(2-methyl-1,3-thiazol-4-yl)trideca-1,5-dien-3-yl] acetate (PubChem CID 123893018) has the molecular formula C26H47NO4SSi2 and a molecular weight of 525.90 g/mol. Its IUPAC name is [2,6,10,12,12-pentamethyl-13,13-bis(methylsilyloxy)-1-(2-methyl-1,3-thiazol-4-yl)trideca-1,5-dien-3-yl] acetate.
| Compound Name | [2,6,10,12,12-pentamethyl-13,13-bis(methylsilyloxy)-1-(2-methyl-1,3-thiazol-4-yl)trideca-1,5-dien-3-yl] acetate |
|---|---|
| PubChem CID | 123893018 |
| Molecular Formula | C26H47NO4SSi2 |
| Molecular Weight | 525.90 g/mol |
| Exact Mass | 525.28 |
| IUPAC Name | [2,6,10,12,12-pentamethyl-13,13-bis(methylsilyloxy)-1-(2-methyl-1,3-thiazol-4-yl)trideca-1,5-dien-3-yl] acetate |
| SMILES | C[SiH2]OC(O[SiH2]C)C(C)(C)CC(C)CCCC(C)=CCC(OC(C)=O)C(C)=Cc1csc(C)n1 |
| InChI | InChI=1S/C26H47NO4SSi2/c1-18(11-10-12-19(2)16-26(6,7)25(30-33-8)31-34-9)13-14-24(29-22(5)28)20(3)15-23-17-32-21(4)27-23/h13,15,17,19,24-25H,10-12,14,16,33-34H2,1-9H3 |
| InChIKey | YCVNFDJLWXQKHW-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.90 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|