C26H29N2O3+ — CID 123893115
[2-[2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-4-hydroxy-1,3,3-trimethylindol-1-ium-5-yl] formate (PubChem CID 123893115) has the molecular formula C26H29N2O3+ and a molecular weight of 417.53 g/mol. Its IUPAC name is [2-[2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-4-hydroxy-1,3,3-trimethylindol-1-ium-5-yl] formate.
| Compound Name | [2-[2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-4-hydroxy-1,3,3-trimethylindol-1-ium-5-yl] formate |
|---|---|
| PubChem CID | 123893115 |
| Molecular Formula | C26H29N2O3+ |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | [2-[2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-4-hydroxy-1,3,3-trimethylindol-1-ium-5-yl] formate |
| SMILES | C[N+]1=C(C=Cc2cc3c4c(c2)CCCN4CCC3)C(C)(C)c2c1ccc(OC=O)c2O |
| InChI | InChI=1S/C26H28N2O3/c1-26(2)22(27(3)20-9-10-21(31-16-29)25(30)23(20)26)11-8-17-14-18-6-4-12-28-13-5-7-19(15-17)24(18)28/h8-11,14-16H,4-7,12-13H2,1-3H3/p+1 |
| InChIKey | OFNKRCJOLZGDTR-UHFFFAOYSA-O |
| XLogP | 4.35 |
| TPSA | 52.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|