C21H34N2O — CID 123893304
2,2-dimethyl-1-[4-(9-methylundeca-2,4,6,9-tetraen-5-yl)piperazin-1-yl]propan-1-one (PubChem CID 123893304) has the molecular formula C21H34N2O and a molecular weight of 330.52 g/mol. Its IUPAC name is 2,2-dimethyl-1-[4-(9-methylundeca-2,4,6,9-tetraen-5-yl)piperazin-1-yl]propan-1-one.
| Compound Name | 2,2-dimethyl-1-[4-(9-methylundeca-2,4,6,9-tetraen-5-yl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 123893304 |
| Molecular Formula | C21H34N2O |
| Molecular Weight | 330.52 g/mol |
| Exact Mass | 330.27 |
| IUPAC Name | 2,2-dimethyl-1-[4-(9-methylundeca-2,4,6,9-tetraen-5-yl)piperazin-1-yl]propan-1-one |
| SMILES | CC=CC=C(C=CCC(C)=CC)N1CCN(C(=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C21H34N2O/c1-7-9-12-19(13-10-11-18(3)8-2)22-14-16-23(17-15-22)20(24)21(4,5)6/h7-10,12-13H,11,14-17H2,1-6H3 |
| InChIKey | XQJXTXMJNYDIAX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.52 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|