C21H26F6N4O3S2 — CID 123893345
1-[4-[3,5-bis(trifluoromethyl)phenyl]piperidin-1-yl]-2-[(4E)-4-hydrazinylidene-1-methylsulfonylpiperidin-3-yl]-2-sulfanylethanone (PubChem CID 123893345) has the molecular formula C21H26F6N4O3S2 and a molecular weight of 560.59 g/mol. Its IUPAC name is 1-[4-[3,5-bis(trifluoromethyl)phenyl]piperidin-1-yl]-2-[(4E)-4-hydrazinylidene-1-methylsulfonylpiperidin-3-yl]-2-sulfanylethanone.
| Compound Name | 1-[4-[3,5-bis(trifluoromethyl)phenyl]piperidin-1-yl]-2-[(4E)-4-hydrazinylidene-1-methylsulfonylpiperidin-3-yl]-2-sulfanylethanone |
|---|---|
| PubChem CID | 123893345 |
| Molecular Formula | C21H26F6N4O3S2 |
| Molecular Weight | 560.59 g/mol |
| Exact Mass | 560.14 |
| IUPAC Name | 1-[4-[3,5-bis(trifluoromethyl)phenyl]piperidin-1-yl]-2-[(4E)-4-hydrazinylidene-1-methylsulfonylpiperidin-3-yl]-2-sulfanylethanone |
| SMILES | CS(=O)(=O)N1CC/C(=N\N)C(C(S)C(=O)N2CCC(c3cc(C(F)(F)F)cc(C(F)(F)F)c3)CC2)C1 |
| InChI | InChI=1S/C21H26F6N4O3S2/c1-36(33,34)31-7-4-17(29-28)16(11-31)18(35)19(32)30-5-2-12(3-6-30)13-8-14(20(22,23)24)10-15(9-13)21(25,26)27/h8-10,12,16,18,35H,2-7,11,28H2,1H3/b29-17+ |
| InChIKey | WFLZQSWPRDFBGW-STBIYBPSSA-N |
| XLogP | 3.32 |
| TPSA | 96.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.59 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|