C12H23NO2 — CID 123893678
ethyl 5-(2,2-dimethylpropyl)pyrrolidine-2-carboxylate (PubChem CID 123893678) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is ethyl 5-(2,2-dimethylpropyl)pyrrolidine-2-carboxylate.
| Compound Name | ethyl 5-(2,2-dimethylpropyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 123893678 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | ethyl 5-(2,2-dimethylpropyl)pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCC(CC(C)(C)C)N1 |
| InChI | InChI=1S/C12H23NO2/c1-5-15-11(14)10-7-6-9(13-10)8-12(2,3)4/h9-10,13H,5-8H2,1-4H3 |
| InChIKey | RPADMPCPZGENLJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |