C27H54 — CID 123893727
1-butan-2-yl-2-(5,7,12,13,13-pentamethyltetradecan-2-yl)cyclobutane (PubChem CID 123893727) has the molecular formula C27H54 and a molecular weight of 378.73 g/mol. Its IUPAC name is 1-butan-2-yl-2-(5,7,12,13,13-pentamethyltetradecan-2-yl)cyclobutane.
| Compound Name | 1-butan-2-yl-2-(5,7,12,13,13-pentamethyltetradecan-2-yl)cyclobutane |
|---|---|
| PubChem CID | 123893727 |
| Molecular Formula | C27H54 |
| Molecular Weight | 378.73 g/mol |
| Exact Mass | 378.42 |
| IUPAC Name | 1-butan-2-yl-2-(5,7,12,13,13-pentamethyltetradecan-2-yl)cyclobutane |
| SMILES | CCC(C)C1CCC1C(C)CCC(C)CC(C)CCCCC(C)C(C)(C)C |
| InChI | InChI=1S/C27H54/c1-10-22(4)25-17-18-26(25)23(5)16-15-21(3)19-20(2)13-11-12-14-24(6)27(7,8)9/h20-26H,10-19H2,1-9H3 |
| InChIKey | BDARDRIIKIAQOY-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.73 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|