C18H21N5O2 — CID 123894268
3-[[6-(cyclohexylmethoxy)-7H-purin-2-yl]amino]phenol (PubChem CID 123894268) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is 3-[[6-(cyclohexylmethoxy)-7H-purin-2-yl]amino]phenol.
| Compound Name | 3-[[6-(cyclohexylmethoxy)-7H-purin-2-yl]amino]phenol |
|---|---|
| PubChem CID | 123894268 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 3-[[6-(cyclohexylmethoxy)-7H-purin-2-yl]amino]phenol |
| SMILES | Oc1cccc(Nc2nc(OCC3CCCCC3)c3[nH]cnc3n2)c1 |
| InChI | InChI=1S/C18H21N5O2/c24-14-8-4-7-13(9-14)21-18-22-16-15(19-11-20-16)17(23-18)25-10-12-5-2-1-3-6-12/h4,7-9,11-12,24H,1-3,5-6,10H2,(H2,19,20,21,22,23) |
| InChIKey | CDKJLBQUZRPGRL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 95.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |