About dimethyl(2-propan-2-ylidenehepta-3,5-dienylidene)azanium
dimethyl(2-propan-2-ylidenehepta-3,5-dienylidene)azanium (PubChem CID 123894351) has the molecular formula C12H20N+
and a molecular weight of 178.30 g/mol. Its IUPAC name is dimethyl(2-propan-2-ylidenehepta-3,5-dienylidene)azanium.
Molecular Properties
| Compound Name | dimethyl(2-propan-2-ylidenehepta-3,5-dienylidene)azanium |
| PubChem CID | 123894351 |
| Molecular Formula | C12H20N+ |
| Molecular Weight | 178.30 g/mol |
| Exact Mass | 178.16 |
| IUPAC Name | dimethyl(2-propan-2-ylidenehepta-3,5-dienylidene)azanium |
| SMILES | CC=CC=CC(C=[N+](C)C)=C(C)C |
| InChI | InChI=1S/C12H20N/c1-6-7-8-9-12(11(2)3)10-13(4)5/h6-10H,1-5H3/q+1 |
| InChIKey | BLYCFNIZKRLVSR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze dimethyl(2-propan-2-ylidenehepta-3,5-dienylidene)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl(2-propan-2-ylidenehepta-3,5-dienylidene)azanium?
The IUPAC name of dimethyl(2-propan-2-ylidenehepta-3,5-dienylidene)azanium (CID 123894351) is dimethyl(2-propan-2-ylidenehepta-3,5-dienylidene)azanium.
What is the SMILES notation for dimethyl(2-propan-2-ylidenehepta-3,5-dienylidene)azanium?
The canonical SMILES for dimethyl(2-propan-2-ylidenehepta-3,5-dienylidene)azanium is CC=CC=CC(C=[N+](C)C)=C(C)C.
What is the InChIKey of dimethyl(2-propan-2-ylidenehepta-3,5-dienylidene)azanium?
The InChIKey is BLYCFNIZKRLVSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N/c1-6-7-8-9-12(11(2)3)10-13(4)5/h6-10H,1-5H3/q+1.
What are the key properties of dimethyl(2-propan-2-ylidenehepta-3,5-dienylidene)azanium?
dimethyl(2-propan-2-ylidenehepta-3,5-dienylidene)azanium has a molecular weight of 178.30 g/mol, XLogP of 2.80, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl(2-propan-2-ylidenehepta-3,5-dienylidene)azanium is sourced from PubChem (CID 123894351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).