C17H23F3O5 — CID 123894588
6-(hydroxymethyl)-2-[3-(5,5,5-trifluoropentoxy)phenyl]oxane-3,4-diol (PubChem CID 123894588) has the molecular formula C17H23F3O5 and a molecular weight of 364.36 g/mol. Its IUPAC name is 6-(hydroxymethyl)-2-[3-(5,5,5-trifluoropentoxy)phenyl]oxane-3,4-diol.
| Compound Name | 6-(hydroxymethyl)-2-[3-(5,5,5-trifluoropentoxy)phenyl]oxane-3,4-diol |
|---|---|
| PubChem CID | 123894588 |
| Molecular Formula | C17H23F3O5 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 6-(hydroxymethyl)-2-[3-(5,5,5-trifluoropentoxy)phenyl]oxane-3,4-diol |
| SMILES | OCC1CC(O)C(O)C(c2cccc(OCCCCC(F)(F)F)c2)O1 |
| InChI | InChI=1S/C17H23F3O5/c18-17(19,20)6-1-2-7-24-12-5-3-4-11(8-12)16-15(23)14(22)9-13(10-21)25-16/h3-5,8,13-16,21-23H,1-2,6-7,9-10H2 |
| InChIKey | JEADSEAHVMGALV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|