C24H24F2N6O3S — CID 123894754
(2R)-N-(cyanomethyl)-2-[2-[[7-[(3,3-dimethyl-1-oxo-1λ6-thiacyclobut-4-en-1-yl)amino]-5-fluoroquinazolin-4-yl]amino]-5-fluorophenoxy]propanamide (PubChem CID 123894754) has the molecular formula C24H24F2N6O3S and a molecular weight of 514.56 g/mol. Its IUPAC name is (2R)-N-(cyanomethyl)-2-[2-[[7-[(3,3-dimethyl-1-oxo-1λ6-thiacyclobut-4-en-1-yl)amino]-5-fluoroquinazolin-4-yl]amino]-5-fluorophenoxy]propanamide.
| Compound Name | (2R)-N-(cyanomethyl)-2-[2-[[7-[(3,3-dimethyl-1-oxo-1λ6-thiacyclobut-4-en-1-yl)amino]-5-fluoroquinazolin-4-yl]amino]-5-fluorophenoxy]propanamide |
|---|---|
| PubChem CID | 123894754 |
| Molecular Formula | C24H24F2N6O3S |
| Molecular Weight | 514.56 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | (2R)-N-(cyanomethyl)-2-[2-[[7-[(3,3-dimethyl-1-oxo-1λ6-thiacyclobut-4-en-1-yl)amino]-5-fluoroquinazolin-4-yl]amino]-5-fluorophenoxy]propanamide |
| SMILES | C[C@@H](Oc1cc(F)ccc1Nc1ncnc2cc(NS3(=O)=CC(C)(C)C3)cc(F)c12)C(=O)NCC#N |
| InChI | InChI=1S/C24H24F2N6O3S/c1-14(23(33)28-7-6-27)35-20-8-15(25)4-5-18(20)31-22-21-17(26)9-16(10-19(21)29-13-30-22)32-36(34)11-24(2,3)12-36/h4-5,8-11,13-14H,7,12H2,1-3H3,(H,28,33)(H,32,34)(H,29,30,31)/t14-,36?/m1/s1 |
| InChIKey | YQEOTNRWKALHNO-NWAYQTQBSA-N |
| XLogP | 3.51 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.56 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|