About N-(6-fluoro-3,4-dimethylocta-4,6-dien-2-yl)propanamide
N-(6-fluoro-3,4-dimethylocta-4,6-dien-2-yl)propanamide (PubChem CID 123895817) has the molecular formula C13H22FNO
and a molecular weight of 227.32 g/mol. Its IUPAC name is N-(6-fluoro-3,4-dimethylocta-4,6-dien-2-yl)propanamide.
Molecular Properties
| Compound Name | N-(6-fluoro-3,4-dimethylocta-4,6-dien-2-yl)propanamide |
| PubChem CID | 123895817 |
| Molecular Formula | C13H22FNO |
| Molecular Weight | 227.32 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | N-(6-fluoro-3,4-dimethylocta-4,6-dien-2-yl)propanamide |
| SMILES | CC=C(F)C=C(C)C(C)C(C)NC(=O)CC |
| InChI | InChI=1S/C13H22FNO/c1-6-12(14)8-9(3)10(4)11(5)15-13(16)7-2/h6,8,10-11H,7H2,1-5H3,(H,15,16) |
| InChIKey | BEBKDQLCKOSUJS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-(6-fluoro-3,4-dimethylocta-4,6-dien-2-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-fluoro-3,4-dimethylocta-4,6-dien-2-yl)propanamide?
The IUPAC name of N-(6-fluoro-3,4-dimethylocta-4,6-dien-2-yl)propanamide (CID 123895817) is N-(6-fluoro-3,4-dimethylocta-4,6-dien-2-yl)propanamide.
What is the SMILES notation for N-(6-fluoro-3,4-dimethylocta-4,6-dien-2-yl)propanamide?
The canonical SMILES for N-(6-fluoro-3,4-dimethylocta-4,6-dien-2-yl)propanamide is CC=C(F)C=C(C)C(C)C(C)NC(=O)CC.
What is the InChIKey of N-(6-fluoro-3,4-dimethylocta-4,6-dien-2-yl)propanamide?
The InChIKey is BEBKDQLCKOSUJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22FNO/c1-6-12(14)8-9(3)10(4)11(5)15-13(16)7-2/h6,8,10-11H,7H2,1-5H3,(H,15,16).
What are the key properties of N-(6-fluoro-3,4-dimethylocta-4,6-dien-2-yl)propanamide?
N-(6-fluoro-3,4-dimethylocta-4,6-dien-2-yl)propanamide has a molecular weight of 227.32 g/mol, XLogP of 3.36, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-fluoro-3,4-dimethylocta-4,6-dien-2-yl)propanamide is sourced from PubChem (CID 123895817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).