About (4-imino-1,3-thiazol-2-yl)-dimethyl-(4-methylpyrrolidine-2-carbonyl)azanium
(4-imino-1,3-thiazol-2-yl)-dimethyl-(4-methylpyrrolidine-2-carbonyl)azanium (PubChem CID 123896178) has the molecular formula C11H19N4OS+
and a molecular weight of 255.37 g/mol. Its IUPAC name is (4-imino-1,3-thiazol-2-yl)-dimethyl-(4-methylpyrrolidine-2-carbonyl)azanium.
Molecular Properties
| Compound Name | (4-imino-1,3-thiazol-2-yl)-dimethyl-(4-methylpyrrolidine-2-carbonyl)azanium |
| PubChem CID | 123896178 |
| Molecular Formula | C11H19N4OS+ |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | (4-imino-1,3-thiazol-2-yl)-dimethyl-(4-methylpyrrolidine-2-carbonyl)azanium |
| SMILES | [H]/N=C1\CSC([N+](C)(C)C(=O)C2CC(C)CN2)=N1 |
| InChI | InChI=1S/C11H19N4OS/c1-7-4-8(13-5-7)10(16)15(2,3)11-14-9(12)6-17-11/h7-8,12-13H,4-6H2,1-3H3/q+1/b12-9+ |
| InChIKey | CVSBPSOTRSOTMC-FMIVXFBMSA-N |
| XLogP | 0.67 |
| TPSA | 65.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (4-imino-1,3-thiazol-2-yl)-dimethyl-(4-methylpyrrolidine-2-carbonyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-imino-1,3-thiazol-2-yl)-dimethyl-(4-methylpyrrolidine-2-carbonyl)azanium?
The IUPAC name of (4-imino-1,3-thiazol-2-yl)-dimethyl-(4-methylpyrrolidine-2-carbonyl)azanium (CID 123896178) is (4-imino-1,3-thiazol-2-yl)-dimethyl-(4-methylpyrrolidine-2-carbonyl)azanium.
What is the SMILES notation for (4-imino-1,3-thiazol-2-yl)-dimethyl-(4-methylpyrrolidine-2-carbonyl)azanium?
The canonical SMILES for (4-imino-1,3-thiazol-2-yl)-dimethyl-(4-methylpyrrolidine-2-carbonyl)azanium is [H]/N=C1\CSC([N+](C)(C)C(=O)C2CC(C)CN2)=N1.
What is the InChIKey of (4-imino-1,3-thiazol-2-yl)-dimethyl-(4-methylpyrrolidine-2-carbonyl)azanium?
The InChIKey is CVSBPSOTRSOTMC-FMIVXFBMSA-N. The full InChI is InChI=1S/C11H19N4OS/c1-7-4-8(13-5-7)10(16)15(2,3)11-14-9(12)6-17-11/h7-8,12-13H,4-6H2,1-3H3/q+1/b12-9+.
What are the key properties of (4-imino-1,3-thiazol-2-yl)-dimethyl-(4-methylpyrrolidine-2-carbonyl)azanium?
(4-imino-1,3-thiazol-2-yl)-dimethyl-(4-methylpyrrolidine-2-carbonyl)azanium has a molecular weight of 255.37 g/mol, XLogP of 0.67, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-imino-1,3-thiazol-2-yl)-dimethyl-(4-methylpyrrolidine-2-carbonyl)azanium is sourced from PubChem (CID 123896178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).