C20H17N3O3S — CID 123896535
N-[5-(benzenesulfonyl)-2-pyridinyl]-2-pyridin-3-ylcyclopropane-1-carboxamide (PubChem CID 123896535) has the molecular formula C20H17N3O3S and a molecular weight of 379.44 g/mol. Its IUPAC name is N-[5-(benzenesulfonyl)-2-pyridinyl]-2-pyridin-3-ylcyclopropane-1-carboxamide.
| Compound Name | N-[5-(benzenesulfonyl)-2-pyridinyl]-2-pyridin-3-ylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 123896535 |
| Molecular Formula | C20H17N3O3S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | N-[5-(benzenesulfonyl)-2-pyridinyl]-2-pyridin-3-ylcyclopropane-1-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)c2ccccc2)cn1)C1CC1c1cccnc1 |
| InChI | InChI=1S/C20H17N3O3S/c24-20(18-11-17(18)14-5-4-10-21-12-14)23-19-9-8-16(13-22-19)27(25,26)15-6-2-1-3-7-15/h1-10,12-13,17-18H,11H2,(H,22,23,24) |
| InChIKey | JKVPYSRUTPLMSY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |