C27H33N3O3 — CID 123896813
3-[(2-benzyl-1-butan-2-ylbenzimidazole-5-carbonyl)iminomethyl]-5-methylhexanoic acid (PubChem CID 123896813) has the molecular formula C27H33N3O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is 3-[(2-benzyl-1-butan-2-ylbenzimidazole-5-carbonyl)iminomethyl]-5-methylhexanoic acid.
| Compound Name | 3-[(2-benzyl-1-butan-2-ylbenzimidazole-5-carbonyl)iminomethyl]-5-methylhexanoic acid |
|---|---|
| PubChem CID | 123896813 |
| Molecular Formula | C27H33N3O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | 3-[(2-benzyl-1-butan-2-ylbenzimidazole-5-carbonyl)iminomethyl]-5-methylhexanoic acid |
| SMILES | CCC(C)n1c(Cc2ccccc2)nc2cc(C(=O)/N=C/C(CC(=O)O)CC(C)C)ccc21 |
| InChI | InChI=1S/C27H33N3O3/c1-5-19(4)30-24-12-11-22(27(33)28-17-21(13-18(2)3)15-26(31)32)16-23(24)29-25(30)14-20-9-7-6-8-10-20/h6-12,16-19,21H,5,13-15H2,1-4H3,(H,31,32)/b28-17+ |
| InChIKey | LURKCBVOZMGVHE-OGLMXYFKSA-N |
| XLogP | 5.95 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|