C47H38Cl4N8O — CID 123897259
4,6-bis[(3-chlorophenyl)methyl]-N-(4-methoxyphenyl)-1,3,5-triazin-2-amine;4,6-bis[(3-chlorophenyl)methyl]-N-phenyl-1,3,5-triazin-2-amine (PubChem CID 123897259) has the molecular formula C47H38Cl4N8O and a molecular weight of 872.69 g/mol. Its IUPAC name is 4,6-bis[(3-chlorophenyl)methyl]-N-(4-methoxyphenyl)-1,3,5-triazin-2-amine;4,6-bis[(3-chlorophenyl)methyl]-N-phenyl-1,3,5-triazin-2-amine.
| Compound Name | 4,6-bis[(3-chlorophenyl)methyl]-N-(4-methoxyphenyl)-1,3,5-triazin-2-amine;4,6-bis[(3-chlorophenyl)methyl]-N-phenyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 123897259 |
| Molecular Formula | C47H38Cl4N8O |
| Molecular Weight | 872.69 g/mol |
| Exact Mass | 870.19 |
| IUPAC Name | 4,6-bis[(3-chlorophenyl)methyl]-N-(4-methoxyphenyl)-1,3,5-triazin-2-amine;4,6-bis[(3-chlorophenyl)methyl]-N-phenyl-1,3,5-triazin-2-amine |
| SMILES | COc1ccc(Nc2nc(Cc3cccc(Cl)c3)nc(Cc3cccc(Cl)c3)n2)cc1.Clc1cccc(Cc2nc(Cc3cccc(Cl)c3)nc(Nc3ccccc3)n2)c1 |
| InChI | InChI=1S/C24H20Cl2N4O.C23H18Cl2N4/c1-31-21-10-8-20(9-11-21)27-24-29-22(14-16-4-2-6-18(25)12-16)28-23(30-24)15-17-5-3-7-19(26)13-17;24-18-8-4-6-16(12-18)14-21-27-22(15-17-7-5-9-19(25)13-17)29-23(28-21)26-20-10-2-1-3-11-20/h2-13H,14-15H2,1H3,(H,27,28,29,30);1-13H,14-15H2,(H,26,27,28,29) |
| InChIKey | BCUQLFLSXBSYRT-UHFFFAOYSA-N |
| XLogP | 12.22 |
| TPSA | 110.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.69 |
| LogP ≤ 5 | 12.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |