C29H50N+ — CID 123897424
(2,8-diethyl-7-methyltrideca-2,3,4,6-tetraenyl)-ethyl-methyl-(5-methylhepta-1,5-dienyl)azanium (PubChem CID 123897424) has the molecular formula C29H50N+ and a molecular weight of 412.73 g/mol. Its IUPAC name is (2,8-diethyl-7-methyltrideca-2,3,4,6-tetraenyl)-ethyl-methyl-(5-methylhepta-1,5-dienyl)azanium.
| Compound Name | (2,8-diethyl-7-methyltrideca-2,3,4,6-tetraenyl)-ethyl-methyl-(5-methylhepta-1,5-dienyl)azanium |
|---|---|
| PubChem CID | 123897424 |
| Molecular Formula | C29H50N+ |
| Molecular Weight | 412.73 g/mol |
| Exact Mass | 412.39 |
| IUPAC Name | (2,8-diethyl-7-methyltrideca-2,3,4,6-tetraenyl)-ethyl-methyl-(5-methylhepta-1,5-dienyl)azanium |
| SMILES | CC=C(C)CCC=C[N+](C)(CC)CC(=C=C=CC=C(C)C(CC)CCCCC)CC |
| InChI | InChI=1S/C29H50N/c1-9-14-15-23-29(12-4)27(7)21-16-17-22-28(11-3)25-30(8,13-5)24-19-18-20-26(6)10-2/h10,16,19,21,24,29H,9,11-15,18,20,23,25H2,1-8H3/q+1/b24-19?,26-10?,27-21?,28-16+ |
| InChIKey | PPQSQGDFYWYJFQ-UGMRZOHWSA-N |
| XLogP | 8.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.73 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|