C28H32BN2O6 — CID 123897633
CID 123897633 (PubChem CID 123897633) has the molecular formula C28H32BN2O6 and a molecular weight of 503.38 g/mol.
| Compound Name | CID 123897633 |
|---|---|
| PubChem CID | 123897633 |
| Molecular Formula | C28H32BN2O6 |
| Molecular Weight | 503.38 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | — |
| SMILES | COc1cc(COc2cccc3c2CN(C2CCC(=O)CC2=O)C3=O)ccc1OCCN1CCCC1.[B] |
| InChI | InChI=1S/C28H32N2O6.B/c1-34-27-15-19(7-10-26(27)35-14-13-29-11-2-3-12-29)18-36-25-6-4-5-21-22(25)17-30(28(21)33)23-9-8-20(31)16-24(23)32;/h4-7,10,15,23H,2-3,8-9,11-14,16-18H2,1H3; |
| InChIKey | CTJIJIPGBFHSJY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|