C22H17N3S — CID 123898287
4-(4-methylsulfanylphenyl)-2,6-dipyridin-4-ylpyridine (PubChem CID 123898287) has the molecular formula C22H17N3S and a molecular weight of 355.47 g/mol. Its IUPAC name is 4-(4-methylsulfanylphenyl)-2,6-dipyridin-4-ylpyridine.
| Compound Name | 4-(4-methylsulfanylphenyl)-2,6-dipyridin-4-ylpyridine |
|---|---|
| PubChem CID | 123898287 |
| Molecular Formula | C22H17N3S |
| Molecular Weight | 355.47 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 4-(4-methylsulfanylphenyl)-2,6-dipyridin-4-ylpyridine |
| SMILES | CSc1ccc(-c2cc(-c3ccncc3)nc(-c3ccncc3)c2)cc1 |
| InChI | InChI=1S/C22H17N3S/c1-26-20-4-2-16(3-5-20)19-14-21(17-6-10-23-11-7-17)25-22(15-19)18-8-12-24-13-9-18/h2-15H,1H3 |
| InChIKey | UVVMOMFAQZTCLK-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.47 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |