C25H25F3N4 — CID 123899367
9,9-diethyl-11-(2-methylphenyl)-14-(trifluoromethyl)-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene (PubChem CID 123899367) has the molecular formula C25H25F3N4 and a molecular weight of 438.50 g/mol. Its IUPAC name is 9,9-diethyl-11-(2-methylphenyl)-14-(trifluoromethyl)-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene.
| Compound Name | 9,9-diethyl-11-(2-methylphenyl)-14-(trifluoromethyl)-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene |
|---|---|
| PubChem CID | 123899367 |
| Molecular Formula | C25H25F3N4 |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 9,9-diethyl-11-(2-methylphenyl)-14-(trifluoromethyl)-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene |
| SMILES | CCC1(CC)Cc2ccccc2N2c3ncc(C(F)(F)F)nc3N(c3ccccc3C)C21 |
| InChI | InChI=1S/C25H25F3N4/c1-4-24(5-2)14-17-11-7-9-13-19(17)32-21-22(30-20(15-29-21)25(26,27)28)31(23(24)32)18-12-8-6-10-16(18)3/h6-13,15,23H,4-5,14H2,1-3H3 |
| InChIKey | MTLCOTHQQBZTIZ-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |