C26H22N3O5S+ — CID 123899795
[1-amino-4-(2,3-dihydro-1H-inden-5-ylamino)-9,10-dioxoanthracen-2-yl]sulfonyl-cyclopropyl-oxoazanium (PubChem CID 123899795) has the molecular formula C26H22N3O5S+ and a molecular weight of 488.55 g/mol. Its IUPAC name is [1-amino-4-(2,3-dihydro-1H-inden-5-ylamino)-9,10-dioxoanthracen-2-yl]sulfonyl-cyclopropyl-oxoazanium.
| Compound Name | [1-amino-4-(2,3-dihydro-1H-inden-5-ylamino)-9,10-dioxoanthracen-2-yl]sulfonyl-cyclopropyl-oxoazanium |
|---|---|
| PubChem CID | 123899795 |
| Molecular Formula | C26H22N3O5S+ |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | [1-amino-4-(2,3-dihydro-1H-inden-5-ylamino)-9,10-dioxoanthracen-2-yl]sulfonyl-cyclopropyl-oxoazanium |
| SMILES | Nc1c(S(=O)(=O)[N+](=O)C2CC2)cc(Nc2ccc3c(c2)CCC3)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C26H21N3O5S/c27-24-21(35(33,34)29(32)17-10-11-17)13-20(28-16-9-8-14-4-3-5-15(14)12-16)22-23(24)26(31)19-7-2-1-6-18(19)25(22)30/h1-2,6-9,12-13,17H,3-5,10-11H2,(H2-,27,28,30,31)/p+1 |
| InChIKey | JRFWLOLXCDONQM-UHFFFAOYSA-O |
| XLogP | 3.91 |
| TPSA | 126.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|