C36H28N2O2 — CID 123899852
2-cyano-3-[4-[4-[4-(N-naphthalen-2-ylanilino)phenyl]buta-1,3-dienyl]phenyl]propanoic acid (PubChem CID 123899852) has the molecular formula C36H28N2O2 and a molecular weight of 520.63 g/mol. Its IUPAC name is 2-cyano-3-[4-[4-[4-(N-naphthalen-2-ylanilino)phenyl]buta-1,3-dienyl]phenyl]propanoic acid.
| Compound Name | 2-cyano-3-[4-[4-[4-(N-naphthalen-2-ylanilino)phenyl]buta-1,3-dienyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 123899852 |
| Molecular Formula | C36H28N2O2 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | 2-cyano-3-[4-[4-[4-(N-naphthalen-2-ylanilino)phenyl]buta-1,3-dienyl]phenyl]propanoic acid |
| SMILES | N#CC(Cc1ccc(C=CC=Cc2ccc(N(c3ccccc3)c3ccc4ccccc4c3)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C36H28N2O2/c37-26-32(36(39)40)24-29-16-14-27(15-17-29)8-4-5-9-28-18-21-34(22-19-28)38(33-12-2-1-3-13-33)35-23-20-30-10-6-7-11-31(30)25-35/h1-23,25,32H,24H2,(H,39,40) |
| InChIKey | CUOQXUZVRNUAEG-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|