C22H32N2 — CID 123899937
1-(2,4,5,6-tetramethylcyclohexa-1,3-dien-1-yl)-3-(2,4,6-trimethylcyclohexa-1,3-dien-1-yl)-2H-imidazole (PubChem CID 123899937) has the molecular formula C22H32N2 and a molecular weight of 324.51 g/mol. Its IUPAC name is 1-(2,4,5,6-tetramethylcyclohexa-1,3-dien-1-yl)-3-(2,4,6-trimethylcyclohexa-1,3-dien-1-yl)-2H-imidazole.
| Compound Name | 1-(2,4,5,6-tetramethylcyclohexa-1,3-dien-1-yl)-3-(2,4,6-trimethylcyclohexa-1,3-dien-1-yl)-2H-imidazole |
|---|---|
| PubChem CID | 123899937 |
| Molecular Formula | C22H32N2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.26 |
| IUPAC Name | 1-(2,4,5,6-tetramethylcyclohexa-1,3-dien-1-yl)-3-(2,4,6-trimethylcyclohexa-1,3-dien-1-yl)-2H-imidazole |
| SMILES | CC1=CC(C)=C(N2C=CN(C3=C(C)C=C(C)C(C)C3C)C2)C(C)C1 |
| InChI | InChI=1S/C22H32N2/c1-14-10-16(3)21(17(4)11-14)23-8-9-24(13-23)22-18(5)12-15(2)19(6)20(22)7/h8-10,12,17,19-20H,11,13H2,1-7H3 |
| InChIKey | RUUBLNUCPCPXQV-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |