C17H11BrFN3O — CID 123899944
(6-bromo-8-fluoroimidazo[1,2-a]pyridin-3-yl)-quinolin-6-ylmethanol (PubChem CID 123899944) has the molecular formula C17H11BrFN3O and a molecular weight of 372.20 g/mol. Its IUPAC name is (6-bromo-8-fluoroimidazo[1,2-a]pyridin-3-yl)-quinolin-6-ylmethanol.
| Compound Name | (6-bromo-8-fluoroimidazo[1,2-a]pyridin-3-yl)-quinolin-6-ylmethanol |
|---|---|
| PubChem CID | 123899944 |
| Molecular Formula | C17H11BrFN3O |
| Molecular Weight | 372.20 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | (6-bromo-8-fluoroimidazo[1,2-a]pyridin-3-yl)-quinolin-6-ylmethanol |
| SMILES | OC(c1ccc2ncccc2c1)c1cnc2c(F)cc(Br)cn12 |
| InChI | InChI=1S/C17H11BrFN3O/c18-12-7-13(19)17-21-8-15(22(17)9-12)16(23)11-3-4-14-10(6-11)2-1-5-20-14/h1-9,16,23H |
| InChIKey | VHMUDTPPCSVPGA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.20 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |