About N-cyclopropyl-4,4,4-trifluoro-3-methylbut-2-enamide
N-cyclopropyl-4,4,4-trifluoro-3-methylbut-2-enamide (PubChem CID 123900241) has the molecular formula C8H10F3NO
and a molecular weight of 193.17 g/mol. Its IUPAC name is N-cyclopropyl-4,4,4-trifluoro-3-methylbut-2-enamide.
Molecular Properties
| Compound Name | N-cyclopropyl-4,4,4-trifluoro-3-methylbut-2-enamide |
| PubChem CID | 123900241 |
| Molecular Formula | C8H10F3NO |
| Molecular Weight | 193.17 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | N-cyclopropyl-4,4,4-trifluoro-3-methylbut-2-enamide |
| SMILES | CC(=CC(=O)NC1CC1)C(F)(F)F |
| InChI | InChI=1S/C8H10F3NO/c1-5(8(9,10)11)4-7(13)12-6-2-3-6/h4,6H,2-3H2,1H3,(H,12,13) |
| InChIKey | BEQMXONLPUTQJZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.17 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopropyl-4,4,4-trifluoro-3-methylbut-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-4,4,4-trifluoro-3-methylbut-2-enamide?
The IUPAC name of N-cyclopropyl-4,4,4-trifluoro-3-methylbut-2-enamide (CID 123900241) is N-cyclopropyl-4,4,4-trifluoro-3-methylbut-2-enamide.
What is the SMILES notation for N-cyclopropyl-4,4,4-trifluoro-3-methylbut-2-enamide?
The canonical SMILES for N-cyclopropyl-4,4,4-trifluoro-3-methylbut-2-enamide is CC(=CC(=O)NC1CC1)C(F)(F)F.
What is the InChIKey of N-cyclopropyl-4,4,4-trifluoro-3-methylbut-2-enamide?
The InChIKey is BEQMXONLPUTQJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F3NO/c1-5(8(9,10)11)4-7(13)12-6-2-3-6/h4,6H,2-3H2,1H3,(H,12,13).
What are the key properties of N-cyclopropyl-4,4,4-trifluoro-3-methylbut-2-enamide?
N-cyclopropyl-4,4,4-trifluoro-3-methylbut-2-enamide has a molecular weight of 193.17 g/mol, XLogP of 1.77, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-4,4,4-trifluoro-3-methylbut-2-enamide is sourced from PubChem (CID 123900241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).