About 2-[(2,3,6-trimethylphenyl)diazenyl]ethanimine
2-[(2,3,6-trimethylphenyl)diazenyl]ethanimine (PubChem CID 123900402) has the molecular formula C11H15N3
and a molecular weight of 189.26 g/mol. Its IUPAC name is 2-[(2,3,6-trimethylphenyl)diazenyl]ethanimine.
Molecular Properties
| Compound Name | 2-[(2,3,6-trimethylphenyl)diazenyl]ethanimine |
| PubChem CID | 123900402 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 2-[(2,3,6-trimethylphenyl)diazenyl]ethanimine |
| SMILES | [H]/N=C/C/N=N/c1c(C)ccc(C)c1C |
| InChI | InChI=1S/C11H15N3/c1-8-4-5-9(2)11(10(8)3)14-13-7-6-12/h4-6,12H,7H2,1-3H3/b12-6+,14-13+ |
| InChIKey | BGSQRYABWUIFCM-ZFNDVPRISA-N |
| XLogP | 3.35 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,3,6-trimethylphenyl)diazenyl]ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,3,6-trimethylphenyl)diazenyl]ethanimine?
The IUPAC name of 2-[(2,3,6-trimethylphenyl)diazenyl]ethanimine (CID 123900402) is 2-[(2,3,6-trimethylphenyl)diazenyl]ethanimine.
What is the SMILES notation for 2-[(2,3,6-trimethylphenyl)diazenyl]ethanimine?
The canonical SMILES for 2-[(2,3,6-trimethylphenyl)diazenyl]ethanimine is [H]/N=C/C/N=N/c1c(C)ccc(C)c1C.
What is the InChIKey of 2-[(2,3,6-trimethylphenyl)diazenyl]ethanimine?
The InChIKey is BGSQRYABWUIFCM-ZFNDVPRISA-N. The full InChI is InChI=1S/C11H15N3/c1-8-4-5-9(2)11(10(8)3)14-13-7-6-12/h4-6,12H,7H2,1-3H3/b12-6+,14-13+.
What are the key properties of 2-[(2,3,6-trimethylphenyl)diazenyl]ethanimine?
2-[(2,3,6-trimethylphenyl)diazenyl]ethanimine has a molecular weight of 189.26 g/mol, XLogP of 3.35, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,3,6-trimethylphenyl)diazenyl]ethanimine is sourced from PubChem (CID 123900402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).