C31H39N5O7S — CID 123900737
[2-[[1-[2-[3-(3-hydroxyphenyl)propylamino]-4,6-dimethylpyrimidin-5-yl]-2-oxoethyl]amino]-3-(thiophene-2-carbonylamino)propanoyl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 123900737) has the molecular formula C31H39N5O7S and a molecular weight of 625.75 g/mol. Its IUPAC name is [2-[[1-[2-[3-(3-hydroxyphenyl)propylamino]-4,6-dimethylpyrimidin-5-yl]-2-oxoethyl]amino]-3-(thiophene-2-carbonylamino)propanoyl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [2-[[1-[2-[3-(3-hydroxyphenyl)propylamino]-4,6-dimethylpyrimidin-5-yl]-2-oxoethyl]amino]-3-(thiophene-2-carbonylamino)propanoyl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 123900737 |
| Molecular Formula | C31H39N5O7S |
| Molecular Weight | 625.75 g/mol |
| Exact Mass | 625.26 |
| IUPAC Name | [2-[[1-[2-[3-(3-hydroxyphenyl)propylamino]-4,6-dimethylpyrimidin-5-yl]-2-oxoethyl]amino]-3-(thiophene-2-carbonylamino)propanoyl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | Cc1nc(NCCCc2cccc(O)c2)nc(C)c1C(C=O)NC(CNC(=O)c1cccs1)C(=O)OCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C31H39N5O7S/c1-19-26(20(2)35-30(34-19)32-13-7-10-21-9-6-11-22(38)15-21)24(17-37)36-23(16-33-27(39)25-12-8-14-44-25)28(40)42-18-43-29(41)31(3,4)5/h6,8-9,11-12,14-15,17,23-24,36,38H,7,10,13,16,18H2,1-5H3,(H,33,39)(H,32,34,35) |
| InChIKey | OAYKUMTWAOELAN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 168.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.75 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|