About 2-dimethylsilylethynyl-ethynyl-methyl-phenylsilane
2-dimethylsilylethynyl-ethynyl-methyl-phenylsilane (PubChem CID 123901120) has the molecular formula C13H16Si2
and a molecular weight of 228.44 g/mol. Its IUPAC name is 2-dimethylsilylethynyl-ethynyl-methyl-phenylsilane.
Molecular Properties
| Compound Name | 2-dimethylsilylethynyl-ethynyl-methyl-phenylsilane |
| PubChem CID | 123901120 |
| Molecular Formula | C13H16Si2 |
| Molecular Weight | 228.44 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 2-dimethylsilylethynyl-ethynyl-methyl-phenylsilane |
| SMILES | C#C[Si](C)(C#C[SiH](C)C)c1ccccc1 |
| InChI | InChI=1S/C13H16Si2/c1-5-15(4,12-11-14(2)3)13-9-7-6-8-10-13/h1,6-10,14H,2-4H3 |
| InChIKey | MTQUTKFMTXUJMR-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.44 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-dimethylsilylethynyl-ethynyl-methyl-phenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-dimethylsilylethynyl-ethynyl-methyl-phenylsilane?
The IUPAC name of 2-dimethylsilylethynyl-ethynyl-methyl-phenylsilane (CID 123901120) is 2-dimethylsilylethynyl-ethynyl-methyl-phenylsilane.
What is the SMILES notation for 2-dimethylsilylethynyl-ethynyl-methyl-phenylsilane?
The canonical SMILES for 2-dimethylsilylethynyl-ethynyl-methyl-phenylsilane is C#C[Si](C)(C#C[SiH](C)C)c1ccccc1.
What is the InChIKey of 2-dimethylsilylethynyl-ethynyl-methyl-phenylsilane?
The InChIKey is MTQUTKFMTXUJMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16Si2/c1-5-15(4,12-11-14(2)3)13-9-7-6-8-10-13/h1,6-10,14H,2-4H3.
What are the key properties of 2-dimethylsilylethynyl-ethynyl-methyl-phenylsilane?
2-dimethylsilylethynyl-ethynyl-methyl-phenylsilane has a molecular weight of 228.44 g/mol, XLogP of 1.71, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-dimethylsilylethynyl-ethynyl-methyl-phenylsilane is sourced from PubChem (CID 123901120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).